| Nom |
B68 |
| Nom anglais |
B68; Pyromellitic acid bis-(2-phenyl-2-imidazoline)salt; 1,2,4,5-Benzenetetracarboxylic acid, compd. with 4,5-dihydro-2-phenyl-1H-imidazole (1:2); Pyromellitic acid 2-phenyl-2-imidazoline salt (1:2); Pyromellitic acid, di(2-phenyl-2-imidazoline) salt; Benzene-1,2,4,5-tetracarboxylic acid, compound with 4,5-dihydro-2-phenyl-1H-imidazole (1:2); benzene-1,2,4,5-tetracarboxylic acid - 2-phenyl-4,5-dihydro-1H-imidazole (1:2) |
| Formule moléculaire |
C28H26N4O8 |
| Poids Moléculaire |
546.528 |
| InChI |
InChI=1/C10H6O8.2C9H10N2/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16;2*1-2-4-8(5-3-1)9-10-6-7-11-9/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);2*1-5H,6-7H2,(H,10,11) |
| Numéro de registre CAS |
54553-91-2 |
| EINECS |
259-226-5 |
| Structure moléculaire |
|
| Point d'ébullition |
585.8°C at 760 mmHg |
| Point d'éclair |
322.1°C |
| Pression de vapeur |
1.45E-14mmHg at 25°C |
| Les symboles de danger |
|
| Codes des risques |
|
| Description de sécurité |
|
|
