ChemNet > CAS > 1011-17-2 N-(2-Hydroxyphenyl)piperazine
1011-17-2 N-(2-Hydroxyphenyl)piperazine
| Ονομασία του προϊόντος |
N-(2-Hydroxyphenyl)piperazine |
| Αγγλικό όνομα |
N-(2-Hydroxyphenyl)piperazine; 1-(2-Hydroxyphenyl)piperazine; 2-(1-Piperazino)phenol; 2-(piperazin-1-yl)phenol; 4-(2-hydroxyphenyl)piperazin-1-ium; N-(2-Hydroxyphenyl) piperazine hcl |
| MF |
C10H15N2O |
| Μοριακό βάρος |
179.2384 |
| InChI |
InChI=1/C10H14N2O/c13-10-4-2-1-3-9(10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2/p+1 |
| CAS ΟΧΙ |
1011-17-2 |
| EINECS |
213-782-5 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
328.2°C at 760 mmHg |
| Σημείο ανάφλεξης |
152.3°C |
| Πίεση ατμών |
0.000101mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
