ChemNet > CAS > 10203-58-4 Diethyl isobutylmalonate
10203-58-4 Diethyl isobutylmalonate
| Ονομασία του προϊόντος |
Diethyl isobutylmalonate |
| Αγγλικό όνομα |
Diethyl isobutylmalonate;Propanedioic acid, 2-(2-methylpropyl)-, 1,3-diethyl ester; AI3-05627; Malonic acid, isobutyl-, diethyl ester; NSC 68522; Propanedioic acid, (2-methylpropyl)-, diethyl ester; diethyl (2-methylpropyl)propanedioate; Isobutylmalonic Acid Diethyl Ester |
| MF |
C11H20O4 |
| Μοριακό βάρος |
216.2741 |
| InChI |
InChI=1/C11H20O4/c1-5-14-10(12)9(7-8(3)4)11(13)15-6-2/h8-9H,5-7H2,1-4H3 |
| CAS ΟΧΙ |
10203-58-4 |
| EINECS |
233-504-6 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.992g/cm3 |
| Σημείο βρασμού |
255°C at 760 mmHg |
| Δείκτης διάθλασης |
1.431 |
| Σημείο ανάφλεξης |
103.1°C |
| Πίεση ατμών |
0.0167mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
