ChemNet > CAS > 10224-72-3 Dimethyl 1,1-cyclobutanedicarboxylate
10224-72-3 Dimethyl 1,1-cyclobutanedicarboxylate
| Ονομασία του προϊόντος |
Dimethyl 1,1-cyclobutanedicarboxylate |
| Αγγλικό όνομα |
Dimethyl 1,1-cyclobutanedicarboxylate; 1,1-Cyclobutanedicarboxylic acid dimethyl ester; Dimethyl1,1-cyclobutanedicarboxylate, (1,1-Cyclobutanedicarboxylicacid dimethylester); dimethyl cyclobutane-1,1-dicarboxylate |
| MF |
C8H12O4 |
| Μοριακό βάρος |
172.1785 |
| InChI |
InChI=1/C8H12O4/c1-11-6(9)8(4-3-5-8)7(10)12-2/h3-5H2,1-2H3 |
| CAS ΟΧΙ |
10224-72-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.19g/cm3 |
| Σημείο βρασμού |
182.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.468 |
| Σημείο ανάφλεξης |
79.5°C |
| Πίεση ατμών |
0.806mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
