103-94-6 4-Nitrophenyloxamic acid

Ονομασία του προϊόντος	4-Nitrophenyloxamic acid
Αγγλικό όνομα	4-Nitrophenyloxamic acid; 4-Nitrooxanilic acid; [(4-nitrophenyl)amino](oxo)acetic acid
MF	C₈H₆N₂O₅
Μοριακό βάρος	210.1436
InChI	InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13)
CAS ΟΧΙ	103-94-6
EINECS	203-160-1
Μοριακή δομή
Πυκνότητα	1.629g/cm³
Δείκτης διάθλασης	1.678
Σύμβολα επικινδυνότητας
Κινδύνου Κώδικες	R36/37/38:Irritating to eyes, respiratory system and skin.;
Περιγραφή της ασφάλειας	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;