ChemNet > CAS > 110888-15-8 4-Chloro-3-fluorobenzonitrile
110888-15-8 4-Chloro-3-fluorobenzonitrile
| Ονομασία του προϊόντος |
4-Chloro-3-fluorobenzonitrile |
| Αγγλικό όνομα |
4-Chloro-3-fluorobenzonitrile; BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
| MF |
C7H3ClFN |
| Μοριακό βάρος |
155.5568 |
| InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| CAS ΟΧΙ |
110888-15-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.33g/cm3 |
| Σημείο τήξης |
79-81°C |
| Σημείο βρασμού |
214°C at 760 mmHg |
| Δείκτης διάθλασης |
1.536 |
| Σημείο ανάφλεξης |
83.2°C |
| Πίεση ατμών |
0.159mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 T,Xi:;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
