ChemNet > CAS > 1117-31-3 1,3-butanediol diacetate
1117-31-3 1,3-butanediol diacetate
Ονομασία του προϊόντος |
1,3-butanediol diacetate |
Αγγλικό όνομα |
1,3-butanediol diacetate; 1,3-butylene diacetate; 1,3-Butylene glycol diacetate; butane-1,3-diyl diacetate; 1,3-BGDA; 1,3-Diacetoxybutane |
MF |
C8H14O4 |
Μοριακό βάρος |
174.1944 |
InChI |
InChI=1/C8H14O4/c1-6(12-8(3)10)4-5-11-7(2)9/h6H,4-5H2,1-3H3 |
CAS ΟΧΙ |
1117-31-3 |
EINECS |
214-244-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.037g/cm3 |
Σημείο βρασμού |
228.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.421 |
Σημείο ανάφλεξης |
102.6°C |
Πίεση ατμών |
0.0722mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|