ChemNet > CAS > 1122-99-2 Cyclopentylacetyl chloride
1122-99-2 Cyclopentylacetyl chloride
Ονομασία του προϊόντος |
Cyclopentylacetyl chloride |
Αγγλικό όνομα |
Cyclopentylacetyl chloride; |
MF |
C7H11ClO |
Μοριακό βάρος |
146.6146 |
InChI |
InChI=1/C7H11ClO/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2 |
CAS ΟΧΙ |
1122-99-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.087g/cm3 |
Σημείο βρασμού |
186°C at 760 mmHg |
Δείκτης διάθλασης |
1.465 |
Σημείο ανάφλεξης |
71.1°C |
Πίεση ατμών |
0.678mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R34:Causes burns.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|