ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
| Ονομασία του προϊόντος |
methyl 4-cyanobenzoate |
| Αγγλικό όνομα |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
| MF |
C9H7NO2 |
| Μοριακό βάρος |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| CAS ΟΧΙ |
1129-35-7 |
| EINECS |
214-443-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.18g/cm3 |
| Σημείο τήξης |
62℃ |
| Σημείο βρασμού |
274.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.535 |
| Σημείο ανάφλεξης |
131.2°C |
| Πίεση ατμών |
0.00526mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
