1129-35-7 methyl 4-cyanobenzoate
Ονομασία του προϊόντος |
methyl 4-cyanobenzoate |
Αγγλικό όνομα |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
MF |
C9H7NO2 |
Μοριακό βάρος |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
CAS ΟΧΙ |
1129-35-7 |
EINECS |
214-443-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.18g/cm3 |
Σημείο τήξης |
62℃ |
Σημείο βρασμού |
274.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.535 |
Σημείο ανάφλεξης |
131.2°C |
Πίεση ατμών |
0.00526mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|