1135-12-2 4-Aminodiphenylmethane
Ονομασία του προϊόντος |
4-Aminodiphenylmethane |
Αγγλικό όνομα |
4-Aminodiphenylmethane; 4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
MF |
C13H13N |
Μοριακό βάρος |
183.249 |
InChI |
InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
CAS ΟΧΙ |
1135-12-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.07g/cm3 |
Σημείο βρασμού |
300°C at 760 mmHg |
Δείκτης διάθλασης |
1.616 |
Σημείο ανάφλεξης |
159.5°C |
Πίεση ατμών |
0.00115mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|