ChemNet > CAS > 1135-67-7 1-Phenyl-1-cyclohexanecarboxylic acid
1135-67-7 1-Phenyl-1-cyclohexanecarboxylic acid
| Ονομασία του προϊόντος |
1-Phenyl-1-cyclohexanecarboxylic acid |
| Αγγλικό όνομα |
1-Phenyl-1-cyclohexanecarboxylic acid;1-Phenylcyclohexane-1-carboxylic acid; 1-phenylcyclohexanecarboxylic acid; 1-phenylcyclohexanecarboxylate |
| MF |
C13H15O2 |
| Μοριακό βάρος |
203.2575 |
| InChI |
InChI=1/C13H16O2/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,14,15)/p-1 |
| CAS ΟΧΙ |
1135-67-7 |
| EINECS |
214-495-8 |
| Μοριακή δομή |
|
| Σημείο τήξης |
119-124℃ |
| Σημείο βρασμού |
353.9°C at 760 mmHg |
| Σημείο ανάφλεξης |
164.9°C |
| Πίεση ατμών |
1.28E-05mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
