ChemNet > CAS > 1198-47-6 2-Amino-6-methylmercaptopurine
1198-47-6 2-Amino-6-methylmercaptopurine
Ονομασία του προϊόντος |
2-Amino-6-methylmercaptopurine |
Αγγλικό όνομα |
2-Amino-6-methylmercaptopurine; |
MF |
C6H7N5S |
Μοριακό βάρος |
181.2183 |
InChI |
InChI=1/C6H7N5S/c1-12-5-3-4(9-2-8-3)10-6(7)11-5/h2-3H,1H3,(H2,7,8,9,10) |
CAS ΟΧΙ |
1198-47-6 |
EINECS |
214-833-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.78g/cm3 |
Σημείο τήξης |
234-237℃ |
Σημείο βρασμού |
344.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.892 |
Σημείο ανάφλεξης |
161.9°C |
Πίεση ατμών |
6.74E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|