ChemNet > CAS > 1202-25-1 Methyl 4-dimethylaminobenzoate
1202-25-1 Methyl 4-dimethylaminobenzoate
Ονομασία του προϊόντος |
Methyl 4-dimethylaminobenzoate |
Αγγλικό όνομα |
Methyl 4-dimethylaminobenzoate; 4-Dimethylaminobenzoic acid methyl ester |
MF |
C10H13NO2 |
Μοριακό βάρος |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-11(2)9-6-4-8(5-7-9)10(12)13-3/h4-7H,1-3H3 |
CAS ΟΧΙ |
1202-25-1 |
EINECS |
214-863-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.084g/cm3 |
Σημείο τήξης |
100-102℃ |
Σημείο βρασμού |
280.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.545 |
Σημείο ανάφλεξης |
112.6°C |
Πίεση ατμών |
0.00381mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|