124-48-1 Chlorodibromomethane
Ονομασία του προϊόντος |
Chlorodibromomethane |
Αγγλικό όνομα |
Chlorodibromomethane; Dibromochloromethane |
MF |
CHBr2Cl |
Μοριακό βάρος |
208.2796 |
InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
CAS ΟΧΙ |
124-48-1 |
EINECS |
204-704-0 |
Μοριακή δομή |
|
Πυκνότητα |
2.504g/cm3 |
Σημείο τήξης |
-22℃ |
Σημείο βρασμού |
117.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.561 |
Σημείο ανάφλεξης |
19.8°C |
Πίεση ατμών |
21mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|