ChemNet > CAS > 126771-41-3 4-(Bromomethyl)phenoxyacetic acid
126771-41-3 4-(Bromomethyl)phenoxyacetic acid
Ονομασία του προϊόντος |
4-(Bromomethyl)phenoxyacetic acid |
Αγγλικό όνομα |
4-(Bromomethyl)phenoxyacetic acid; |
MF |
C9H9BrO3 |
Μοριακό βάρος |
245.07 |
InChI |
InChI=1/C9H9BrO3/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
CAS ΟΧΙ |
126771-41-3 |
Μοριακή δομή |
|
Πυκνότητα |
1.59g/cm3 |
Σημείο βρασμού |
363°C at 760 mmHg |
Δείκτης διάθλασης |
1.587 |
Σημείο ανάφλεξης |
173.3°C |
Πίεση ατμών |
6.63E-06mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|