ChemNet > CAS > 13294-71-8 2-Bromo-2-butene, mixture of cis and trans
13294-71-8 2-Bromo-2-butene, mixture of cis and trans
| Ονομασία του προϊόντος |
2-Bromo-2-butene, mixture of cis and trans |
| Αγγλικό όνομα |
2-Bromo-2-butene, mixture of cis and trans; 2-Bromo-2-butene (cis+trans); Bromobutenecistrans; 2-Bromo-2-butene; 2-bromobut-2-ene; (2Z)-2-bromobut-2-ene; (2E)-2-bromobut-2-ene |
| MF |
C4H7Br |
| Μοριακό βάρος |
135.0024 |
| InChI |
InChI=1/C4H7Br/c1-3-4(2)5/h3H,1-2H3/b4-3+ |
| CAS ΟΧΙ |
13294-71-8 |
| EINECS |
236-316-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.334g/cm3 |
| Σημείο βρασμού |
93.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.469 |
| Σημείο ανάφλεξης |
13.6°C |
| Πίεση ατμών |
55.2mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 F:Highly flammable;
|
| Κινδύνου Κώδικες |
R11:Highly flammable.;
|
| Περιγραφή της ασφάλειας |
S16:Keep away from sources of ignition - No smoking.;
|
|
