ChemNet > CAS > 135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
| Ονομασία του προϊόντος |
2,4,6-Trimethoxybenzeneboronic acid |
| Αγγλικό όνομα |
2,4,6-Trimethoxybenzeneboronic acid; 2,4,6-Trimethoxyphenylboronic acid |
| MF |
C9H13BO5 |
| Μοριακό βάρος |
212.0075 |
| InChI |
InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
| CAS ΟΧΙ |
135159-25-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.21g/cm3 |
| Σημείο βρασμού |
413.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.513 |
| Σημείο ανάφλεξης |
204.1°C |
| Πίεση ατμών |
1.37E-07mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
