ChemNet > CAS > 145689-34-5 2,3-difluorophenylacetonitrile
145689-34-5 2,3-difluorophenylacetonitrile
| Ονομασία του προϊόντος |
2,3-difluorophenylacetonitrile |
| Αγγλικό όνομα |
2,3-difluorophenylacetonitrile; 2,3-Difluorobenzylcyanide; 2,3-difluorophenylacetanitrile |
| MF |
C8H5F2N |
| Μοριακό βάρος |
153.1288 |
| InChI |
InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
| CAS ΟΧΙ |
145689-34-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.234g/cm3 |
| Σημείο βρασμού |
216.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.487 |
| Σημείο ανάφλεξης |
85°C |
| Πίεση ατμών |
0.136mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
