ChemNet > CAS > 14765-30-1 2-sec-butylcyclohexanone
14765-30-1 2-sec-butylcyclohexanone
Ονομασία του προϊόντος |
2-sec-butylcyclohexanone |
Αγγλικό όνομα |
2-sec-butylcyclohexanone; Cyclohexanone, 2-(1-methylpropyl)-; 2-(1-Methylpropyl)cyclohexanone; 2-sec-Butylcyclohexanone; BRN 1859137; Butylcyclohexanone, O-sec-; Cyclohexanone, 2-sec-butyl-; FEMA No. 3261; NSC 21146; UNII-5WA6R1KL5J; 2-sec-Butylcyclohexan-1-one; Cyclohexanone, 2-sec-butyl-; 2-(butan-2-yl)cyclohexanone; 2-(1-Methylpropyl)-Cyclohexanone |
MF |
C10H18O |
Μοριακό βάρος |
154.2493 |
InChI |
InChI=1/C10H18O/c1-3-8(2)9-6-4-5-7-10(9)11/h8-9H,3-7H2,1-2H3 |
CAS ΟΧΙ |
14765-30-1 |
EINECS |
238-830-2 |
Μοριακή δομή |
|
Πυκνότητα |
0.899g/cm3 |
Σημείο βρασμού |
213.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.452 |
Σημείο ανάφλεξης |
75.8°C |
Πίεση ατμών |
0.163mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|