ChemNet > CAS > 1544-85-0 2,2-difluoro-5-aminobenzodioxole
1544-85-0 2,2-difluoro-5-aminobenzodioxole
Ονομασία του προϊόντος |
2,2-difluoro-5-aminobenzodioxole |
Αγγλικό όνομα |
2,2-difluoro-5-aminobenzodioxole; 2,2-Difluoro-5-amino-1,3-benzodioxole; 2,2-difluorobenzo[d][1,3]dioxol-5-amine; 1-(difluoromethoxy)-4-nitrobenzene; 2,2-Difluoro-5-aminobenzo[d][1,3]dioxole |
MF |
C7H5F2NO3 |
Μοριακό βάρος |
189.1163 |
InChI |
InChI=1/C7H5F2NO3/c8-7(9)13-6-3-1-5(2-4-6)10(11)12/h1-4,7H |
CAS ΟΧΙ |
1544-85-0 |
Μοριακή δομή |
|
Πυκνότητα |
1.384g/cm3 |
Σημείο βρασμού |
259.6°C at 760 mmHg |
Δείκτης διάθλασης |
1.494 |
Σημείο ανάφλεξης |
110.8°C |
Πίεση ατμών |
0.0208mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|