1556-18-9 Iodocyclopentane
Ονομασία του προϊόντος |
Iodocyclopentane |
Αγγλικό όνομα |
Iodocyclopentane; Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
MF |
C8H7NOS |
Μοριακό βάρος |
165.2123 |
InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
CAS ΟΧΙ |
1556-18-9 |
EINECS |
216-311-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.08g/cm3 |
Σημείο βρασμού |
280.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.551 |
Σημείο ανάφλεξης |
123.4°C |
Πίεση ατμών |
0.00642mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|