ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
Ονομασία του προϊόντος |
5-Nitrothiophene-2-carbonitrile |
Αγγλικό όνομα |
5-Nitrothiophene-2-carbonitrile; 2-Cyano-5-nitrothiophene |
MF |
C5H2N2O2S |
Μοριακό βάρος |
154.1466 |
InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
CAS ΟΧΙ |
16689-02-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.5g/cm3 |
Σημείο βρασμού |
273.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.611 |
Σημείο ανάφλεξης |
119.4°C |
Πίεση ατμών |
0.00558mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|