ChemNet > CAS > 1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
Ονομασία του προϊόντος |
1,6-Diphenyl-1,3,5-hexatriene |
Αγγλικό όνομα |
1,6-Diphenyl-1,3,5-hexatriene; DPH; 1,1'-hexa-1,3,5-triene-1,6-diyldibenzene; 1,1'-(1E,3E,5E)-hexa-1,3,5-triene-1,6-diyldibenzene; 1-phenylhexa-1,3,5-trienylbenzene |
MF |
C18H16 |
Μοριακό βάρος |
232.3196 |
InChI |
InChI=1/C18H16/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h2-15H,1H2 |
CAS ΟΧΙ |
1720-32-7 |
EINECS |
217-011-3 |
Μοριακή δομή |
|
Πυκνότητα |
0.988g/cm3 |
Σημείο τήξης |
199-203℃ |
Σημείο βρασμού |
361°C at 760 mmHg |
Δείκτης διάθλασης |
1.585 |
Σημείο ανάφλεξης |
185.3°C |
Πίεση ατμών |
4.44E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|