ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
| Ονομασία του προϊόντος |
2,3-Dichlorothiophene |
| Αγγλικό όνομα |
2,3-Dichlorothiophene; 2,3-dichloro-thiophene |
| MF |
C4H2Cl2S |
| Μοριακό βάρος |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| CAS ΟΧΙ |
17249-79-5;17249-29-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.488g/cm3 |
| Σημείο τήξης |
-26℃ |
| Σημείο βρασμού |
170.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.584 |
| Σημείο ανάφλεξης |
68.9°C |
| Πίεση ατμών |
1.93mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
