17249-79-5;17249-29-5 2,3-Dichlorothiophene
Ονομασία του προϊόντος |
2,3-Dichlorothiophene |
Αγγλικό όνομα |
2,3-Dichlorothiophene; 2,3-dichloro-thiophene |
MF |
C4H2Cl2S |
Μοριακό βάρος |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
CAS ΟΧΙ |
17249-79-5;17249-29-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.488g/cm3 |
Σημείο τήξης |
-26℃ |
Σημείο βρασμού |
170.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.584 |
Σημείο ανάφλεξης |
68.9°C |
Πίεση ατμών |
1.93mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|