ChemNet > CAS > 17302-82-8 Ethyl 3,5-dichloro-4-hydroxybenzoate
17302-82-8 Ethyl 3,5-dichloro-4-hydroxybenzoate
| Ονομασία του προϊόντος |
Ethyl 3,5-dichloro-4-hydroxybenzoate |
| Αγγλικό όνομα |
Ethyl 3,5-dichloro-4-hydroxybenzoate; 3,5-Dichloro-4-hydroxybenzoic acid ethyl ester |
| MF |
C9H8Cl2O3 |
| Μοριακό βάρος |
235.064 |
| InChI |
InChI=1/C9H8Cl2O3/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,12H,2H2,1H3 |
| CAS ΟΧΙ |
17302-82-8 |
| EINECS |
241-331-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.414g/cm3 |
| Σημείο τήξης |
98-102℃ |
| Σημείο βρασμού |
316.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.567 |
| Σημείο ανάφλεξης |
145.3°C |
| Πίεση ατμών |
0.000219mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
