1731-79-9 dimethyl dodecanedioate
Ονομασία του προϊόντος |
dimethyl dodecanedioate |
Αγγλικό όνομα |
dimethyl dodecanedioate; Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
MF |
C14H26O4 |
Μοριακό βάρος |
258.3538 |
InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
CAS ΟΧΙ |
1731-79-9 |
EINECS |
217-050-6 |
Μοριακή δομή |
|
Πυκνότητα |
0.969g/cm3 |
Σημείο βρασμού |
300.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.441 |
Σημείο ανάφλεξης |
135°C |
Πίεση ατμών |
0.00109mmHg at 25°C |
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|