ChemNet > CAS > 175883-62-2 (4-Methoxy-3-methylphenyl)boronic acid
175883-62-2 (4-Methoxy-3-methylphenyl)boronic acid
Ονομασία του προϊόντος |
(4-Methoxy-3-methylphenyl)boronic acid |
Αγγλικό όνομα |
(4-Methoxy-3-methylphenyl)boronic acid; 4-Methoxy-3-methylphenylboronic acid; 4-Methoxy-3-methylbenzeneboronic acid |
MF |
C8H11BO3 |
Μοριακό βάρος |
165.9821 |
InChI |
InChI=1/C8H11BO3/c1-6-5-7(9(10)11)3-4-8(6)12-2/h3-5,10-11H,1-2H3 |
CAS ΟΧΙ |
175883-62-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.14g/cm3 |
Σημείο βρασμού |
321.4°C at 760 mmHg |
Δείκτης διάθλασης |
1.52 |
Σημείο ανάφλεξης |
148.2°C |
Πίεση ατμών |
0.000124mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|