ChemNet > CAS > 1877-71-0 Methyl hydrogen isophthalate
1877-71-0 Methyl hydrogen isophthalate
| Ονομασία του προϊόντος |
Methyl hydrogen isophthalate |
| Αγγλικό όνομα |
Methyl hydrogen isophthalate; Monomethyl isophthalate; Isophthalic acid monomethyl ester; Benzene-1,3-dicarboxylic acid monomethyl ester; 3-(methoxycarbonyl)benzoic acid; Mono-methyl isophthalate; Isophthalic acid methyl ester |
| MF |
C9H8O4 |
| Μοριακό βάρος |
180.1574 |
| InChI |
InChI=1/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
| CAS ΟΧΙ |
1877-71-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.288g/cm3 |
| Σημείο τήξης |
194-196℃ |
| Σημείο βρασμού |
339.3°C at 760 mmHg |
| Δείκτης διάθλασης |
1.556 |
| Σημείο ανάφλεξης |
139.6°C |
| Πίεση ατμών |
3.6E-05mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
