18937-79-6 Methyl 2-hexynoate
Ονομασία του προϊόντος |
Methyl 2-hexynoate |
Αγγλικό όνομα |
Methyl 2-hexynoate; 2-Hexynoic acid methyl ester; methyl hex-2-ynoate |
MF |
C7H10O2 |
Μοριακό βάρος |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-3-4-5-6-7(8)9-2/h3-4H2,1-2H3 |
CAS ΟΧΙ |
18937-79-6 |
EINECS |
242-690-8 |
Μοριακή δομή |
|
Πυκνότητα |
0.963g/cm3 |
Σημείο βρασμού |
184.4°C at 760 mmHg |
Δείκτης διάθλασης |
1.436 |
Σημείο ανάφλεξης |
65.4°C |
Πίεση ατμών |
0.734mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|