ChemNet > CAS > 19438-60-9 Hexahydro-4-methylphthalic anhydride, mixture of cis and trans
19438-60-9 Hexahydro-4-methylphthalic anhydride, mixture of cis and trans
| Ονομασία του προϊόντος |
Hexahydro-4-methylphthalic anhydride, mixture of cis and trans |
| Αγγλικό όνομα |
Hexahydro-4-methylphthalic anhydride, mixture of cis and trans; 4-Methyl-1,2-cyclohexanedicarboxylic anhydride; Methylaexahydrophthalic Anhydride; Hexahydro-4-methylphthalic anhydride; Hexahydro-4-methylphthalic anhydride, mixture of isomers; 5-methylhexahydro-2-benzofuran-1,3-dione; 4-MHHPA |
| MF |
C9H12O3 |
| Μοριακό βάρος |
168.189804 |
| InChI |
InChI=1S/C9H12O3/c1-5-2-3-6-7(4-5)9(11)12-8(6)10/h5-7H,2-4H2,1H3 |
| CAS ΟΧΙ |
19438-60-9 |
| EINECS |
243-072-0 |
| Μοριακή δομή |
|
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
|
|
