ChemNet > CAS > 2016-05-9 N,N-Dimethylformamide dicyclohexyl acetal
2016-05-9 N,N-Dimethylformamide dicyclohexyl acetal
| Ονομασία του προϊόντος |
N,N-Dimethylformamide dicyclohexyl acetal |
| Αγγλικό όνομα |
N,N-Dimethylformamide dicyclohexyl acetal; 1,1-Dicyclohexyloxytrimethylamine; 1,1-bis(cyclohexyloxy)-N,N-dimethylmethanamine; bis(cyclohexyloxy)-N,N-dimethylmethanaminium |
| MF |
C15H30NO2 |
| Μοριακό βάρος |
256.4037 |
| InChI |
InChI=1/C15H29NO2/c1-16(2)15(17-13-9-5-3-6-10-13)18-14-11-7-4-8-12-14/h13-15H,3-12H2,1-2H3/p+1 |
| CAS ΟΧΙ |
2016-05-9 |
| EINECS |
217-947-2 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
310.5°C at 760 mmHg |
| Σημείο ανάφλεξης |
90.6°C |
| Πίεση ατμών |
0.000596mmHg at 25°C |
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|