ChemNet > CAS > 202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
Ονομασία του προϊόντος |
2-Bromo-4-fluoro-1-iodobenzene |
Αγγλικό όνομα |
2-Bromo-4-fluoro-1-iodobenzene; 2-Bromo-4-fluoroiodobenzene; 1-Bromo-5-fluoro-2-iodobenzene |
MF |
C6H3BrFI |
Μοριακό βάρος |
300.8949 |
InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
CAS ΟΧΙ |
202865-73-4 |
Μοριακή δομή |
|
Πυκνότητα |
2.281g/cm3 |
Σημείο βρασμού |
243.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.628 |
Σημείο ανάφλεξης |
100.9°C |
Πίεση ατμών |
0.0507mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|