202865-85-8 2-Bromo-5-iodotoluene
Ονομασία του προϊόντος |
2-Bromo-5-iodotoluene |
Αγγλικό όνομα |
2-Bromo-5-iodotoluene;1-bromo-4-iodo-2-methylbenzene |
MF |
C7H6BrI |
Μοριακό βάρος |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
CAS ΟΧΙ |
202865-85-8 |
Μοριακή δομή |
|
Πυκνότητα |
2.062g/cm3 |
Σημείο βρασμού |
264.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.636 |
Σημείο ανάφλεξης |
113.6°C |
Πίεση ατμών |
0.0161mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|