ChemNet > CAS > 20666-12-0 5-amino-2,3-dihydro-1,4-*phthalazinedione sodium
20666-12-0 5-amino-2,3-dihydro-1,4-*phthalazinedione sodium
Ονομασία του προϊόντος |
5-amino-2,3-dihydro-1,4-*phthalazinedione sodium |
Αγγλικό όνομα |
5-amino-2,3-dihydro-1,4-*phthalazinedione sodium; 3-Aminophthalhydrazide monosodium salt; Luminol monosodium salt~Sodium luminol; 5-amino-2,3-dihydrophthalazine-1,4-dione; 1,4-phthalazinedione, 5-amino-2,3-dihydro-, sodium salt (1:1); 3-aminophthalhydrazidemonosodium salt |
MF |
C8H7N3NaO2 |
Μοριακό βάρος |
200.1498 |
InChI |
InChI=1/C8H7N3O2.Na/c9-5-3-1-2-4-6(5)8(13)11-10-7(4)12;/h1-3H,9H2,(H,10,12)(H,11,13); |
CAS ΟΧΙ |
20666-12-0 |
EINECS |
208-309-4 |
Μοριακή δομή |
|
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|