ChemNet > CAS > 21211-07-4 Methyl 3-chlorobenzo(b)thiophene-2-carboxylate
21211-07-4 Methyl 3-chlorobenzo(b)thiophene-2-carboxylate
| Ονομασία του προϊόντος |
Methyl 3-chlorobenzo(b)thiophene-2-carboxylate |
| Αγγλικό όνομα |
Methyl 3-chlorobenzo(b)thiophene-2-carboxylate; Methylchlorobenzobthiophenecarboxylate; methyl 3-chloro-1-benzothiophene-2-carboxylate; Methyl 3-chlorobenzo[b]thiophene-2-carboxylate |
| MF |
C10H7ClO2S |
| Μοριακό βάρος |
226.6794 |
| InChI |
InChI=1/C10H7ClO2S/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5H,1H3 |
| CAS ΟΧΙ |
21211-07-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.391g/cm3 |
| Σημείο τήξης |
80-82℃ |
| Σημείο βρασμού |
338.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.646 |
| Σημείο ανάφλεξης |
158.7°C |
| Πίεση ατμών |
9.6E-05mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
