ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
Ονομασία του προϊόντος |
3-(trifluoromethyl)phenoxyacetonitrile |
Αγγλικό όνομα |
3-(trifluoromethyl)phenoxyacetonitrile; 2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
MF |
C8H7FO3 |
Μοριακό βάρος |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
CAS ΟΧΙ |
2145-31-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.309g/cm3 |
Σημείο βρασμού |
268.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.526 |
Σημείο ανάφλεξης |
116.4°C |
Πίεση ατμών |
0.00452mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|