ChemNet > CAS > 216144-91-1 3-(2-Carboxyvinyl)benzeneboronic acid
216144-91-1 3-(2-Carboxyvinyl)benzeneboronic acid
| Ονομασία του προϊόντος |
3-(2-Carboxyvinyl)benzeneboronic acid |
| Αγγλικό όνομα |
3-(2-Carboxyvinyl)benzeneboronic acid; 3-(2-Carboxyvinyl)phenylboronic acid; 3-Boronocinnamic acid; (2E)-3-[3-(dihydroxyboranyl)phenyl]prop-2-enoic acid |
| MF |
C9H9BO4 |
| Μοριακό βάρος |
191.9764 |
| InChI |
InChI=1/C9H9BO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6,13-14H,(H,11,12)/b5-4+ |
| CAS ΟΧΙ |
216144-91-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.33g/cm3 |
| Σημείο βρασμού |
454.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.591 |
| Σημείο ανάφλεξης |
228.4°C |
| Πίεση ατμών |
4.91E-09mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
