ChemNet > CAS > 216394-06-8 (1R,2R)-(-)-2-Benzyloxycyclohexylamine
216394-06-8 (1R,2R)-(-)-2-Benzyloxycyclohexylamine
| Ονομασία του προϊόντος |
(1R,2R)-(-)-2-Benzyloxycyclohexylamine |
| Αγγλικό όνομα |
(1R,2R)-(-)-2-Benzyloxycyclohexylamine; (1R,2R)-(-)-1-Amino-2-benzyloxycyclohexane; (1R-trans)-(-)-2-(Phenylmethoxy)cyclohexanamine; (1R-trans)-2-(Phenylmethoxy)cyclohexaneamine; (1R,2R)-2-(benzyloxy)cyclohexanamine; (1R,2R)-2-phenylmethoxycyclohexan-1-amine |
| MF |
C13H19NO |
| Μοριακό βάρος |
205.2961 |
| InChI |
InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m1/s1 |
| CAS ΟΧΙ |
216394-06-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.039g/cm3 |
| Σημείο βρασμού |
306.148°C at 760 mmHg |
| Δείκτης διάθλασης |
1.545 |
| Σημείο ανάφλεξης |
133.224°C |
| Πίεση ατμών |
0.001mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
