ChemNet > CAS > 22134-11-8 2,4,6-Tribromophenyl isothiocyanate
22134-11-8 2,4,6-Tribromophenyl isothiocyanate
| Ονομασία του προϊόντος |
2,4,6-Tribromophenyl isothiocyanate |
| Αγγλικό όνομα |
2,4,6-Tribromophenyl isothiocyanate;1,3,5-tribromo-2-isothiocyanatobenzene |
| MF |
C7H2Br3NS |
| Μοριακό βάρος |
371.8745 |
| InChI |
InChI=1/C7H2Br3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| CAS ΟΧΙ |
22134-11-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
2.21g/cm3 |
| Σημείο βρασμού |
380.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.706 |
| Σημείο ανάφλεξης |
183.7°C |
| Πίεση ατμών |
1.22E-05mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
