ChemNet > CAS > 22236-04-0 2-(difluoromethoxy)aniline
22236-04-0 2-(difluoromethoxy)aniline
| Ονομασία του προϊόντος |
2-(difluoromethoxy)aniline |
| Αγγλικό όνομα |
2-(difluoromethoxy)aniline; 2-Difluoromethoxyaniline |
| MF |
C7H7F2NO |
| Μοριακό βάρος |
159.1334 |
| InChI |
InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
| CAS ΟΧΙ |
22236-04-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.253g/cm3 |
| Σημείο βρασμού |
209.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.501 |
| Σημείο ανάφλεξης |
80.7°C |
| Πίεση ατμών |
0.199mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
