ChemNet > CAS > 226396-32-3 2,3,4-Trifluorophenylboronic acid
226396-32-3 2,3,4-Trifluorophenylboronic acid
| Ονομασία του προϊόντος |
2,3,4-Trifluorophenylboronic acid |
| Αγγλικό όνομα |
2,3,4-Trifluorophenylboronic acid; |
| MF |
C6H4BF3O2 |
| Μοριακό βάρος |
175.901 |
| InChI |
InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
| CAS ΟΧΙ |
226396-32-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.44g/cm3 |
| Σημείο τήξης |
229-235℃ |
| Σημείο βρασμού |
260.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.465 |
| Σημείο ανάφλεξης |
111.2°C |
| Πίεση ατμών |
0.00629mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
