229-87-8 Phenanthridine
Ονομασία του προϊόντος |
Phenanthridine |
Αγγλικό όνομα |
Phenanthridine; Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
MF |
C13H9N |
Μοριακό βάρος |
179.2173 |
InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
CAS ΟΧΙ |
229-87-8 |
EINECS |
205-934-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.187g/cm3 |
Σημείο τήξης |
104-107℃ |
Σημείο βρασμού |
340.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.726 |
Σημείο ανάφλεξης |
155.9°C |
Πίεση ατμών |
0.000166mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R40:Possible risks of irreversible effects.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|