2444-37-3 (Methylthio)acetic acid
Ονομασία του προϊόντος |
(Methylthio)acetic acid |
Αγγλικό όνομα |
(Methylthio)acetic acid; NSC 263480; (methylsulfanyl)acetic acid |
MF |
C3H6O2S |
Μοριακό βάρος |
106.1435 |
InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
CAS ΟΧΙ |
2444-37-3 |
EINECS |
219-483-6 |
Μοριακή δομή |
|
Πυκνότητα |
1.224g/cm3 |
Σημείο τήξης |
13-131℃ |
Σημείο βρασμού |
225.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.5 |
Σημείο ανάφλεξης |
90.4°C |
Πίεση ατμών |
0.0307mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|