ChemNet > CAS > 247940-06-3 2-(Dicyclohexylphosphino)biphenyl
247940-06-3 2-(Dicyclohexylphosphino)biphenyl
Ονομασία του προϊόντος |
2-(Dicyclohexylphosphino)biphenyl |
Αγγλικό όνομα |
2-(Dicyclohexylphosphino)biphenyl; (2-Biphenylyl)dicyclohexylphosphine; biphenyl-2-yl(dicyclohexyl)phosphane; CyJohnPhos |
MF |
C24H31P |
Μοριακό βάρος |
350.4767 |
InChI |
InChI=1/C24H31P/c1-4-12-20(13-5-1)23-18-10-11-19-24(23)25(21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1,4-5,10-13,18-19,21-22H,2-3,6-9,14-17H2 |
CAS ΟΧΙ |
247940-06-3 |
Μοριακή δομή |
|
Σημείο τήξης |
103℃ |
Σημείο βρασμού |
499.5°C at 760 mmHg |
Σημείο ανάφλεξης |
271.7°C |
Πίεση ατμών |
1.27E-09mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|