ChemNet > CAS > 25153-40-6 Methyl vinyl ether/maleic acid copolymer
25153-40-6 Methyl vinyl ether/maleic acid copolymer
| Ονομασία του προϊόντος |
Methyl vinyl ether/maleic acid copolymer |
| Αγγλικό όνομα |
Methyl vinyl ether/maleic acid copolymer; Poly(methyl vinyl ether-alt-maleic acid); methoxyethene-(2Z)-but-2-enedioic acid (1:1); poly(methyl vinyl ether/maleic acid)copolymer; Poly( methyl vinyl ether/maleic acid）copolymer (PP series) |
| MF |
C7H10O5 |
| Μοριακό βάρος |
174.1513 |
| InChI |
InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
| CAS ΟΧΙ |
25153-40-6 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
355.5°C at 760 mmHg |
| Σημείο ανάφλεξης |
183°C |
| Πίεση ατμών |
5.19E-06mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
