ChemNet > CAS > 25173-72-2 3-(3,4,5-Trimethoxyphenyl)propionic acid
25173-72-2 3-(3,4,5-Trimethoxyphenyl)propionic acid
Ονομασία του προϊόντος |
3-(3,4,5-Trimethoxyphenyl)propionic acid |
Αγγλικό όνομα |
3-(3,4,5-Trimethoxyphenyl)propionic acid; 3,4,5-Trimethoxyhydrocinnamic acid; 3-(3,4,5-trimethoxyphenyl)propanoic acid; 3-(3,4,5-trimethoxyphenyl)propanoate |
MF |
C12H15O5 |
Μοριακό βάρος |
239.245 |
InChI |
InChI=1/C12H16O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h6-7H,4-5H2,1-3H3,(H,13,14)/p-1 |
CAS ΟΧΙ |
25173-72-2 |
EINECS |
246-706-4 |
Μοριακή δομή |
|
Σημείο τήξης |
100-105℃ |
Σημείο βρασμού |
373.3°C at 760 mmHg |
Σημείο ανάφλεξης |
139.9°C |
Πίεση ατμών |
3.1E-06mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|