ChemNet > CAS > 25781-92-4 5-Chloro-2-nitrodiphenylamine
25781-92-4 5-Chloro-2-nitrodiphenylamine
Ονομασία του προϊόντος |
5-Chloro-2-nitrodiphenylamine |
Αγγλικό όνομα |
5-Chloro-2-nitrodiphenylamine; 2-nitro-5-chlorodiphenyl amine; 5-chloro-2-nitro-N-phenylaniline |
MF |
C12H9ClN2O2 |
Μοριακό βάρος |
248.6651 |
InChI |
InChI=1/C12H9ClN2O2/c13-9-6-7-12(15(16)17)11(8-9)14-10-4-2-1-3-5-10/h1-8,14H |
CAS ΟΧΙ |
25781-92-4 |
EINECS |
247-261-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.387g/cm3 |
Σημείο τήξης |
110-114℃ |
Σημείο βρασμού |
370.4°C at 760 mmHg |
Δείκτης διάθλασης |
1.671 |
Σημείο ανάφλεξης |
177.8°C |
Πίεση ατμών |
1.11E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|