2628-17-3 4-Vinylphenol
Ονομασία του προϊόντος |
4-Vinylphenol |
Αγγλικό όνομα |
4-Vinylphenol; 4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
MF |
C8H8O |
Μοριακό βάρος |
120.15 |
InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
CAS ΟΧΙ |
2628-17-3 |
EINECS |
220-103-6 |
Μοριακή δομή |
|
Σημείο τήξης |
73℃ |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|