ChemNet > CAS > 279261-89-1 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid
279261-89-1 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid
Ονομασία του προϊόντος |
3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid |
Αγγλικό όνομα |
3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid; Boronic acid,B-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)- |
MF |
C9H11BO4 |
Μοριακό βάρος |
193.9922 |
InChI |
InChI=1/C9H11BO4/c11-10(12)7-2-3-8-9(6-7)14-5-1-4-13-8/h2-3,6,11-12H,1,4-5H2 |
CAS ΟΧΙ |
279261-89-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.29g/cm3 |
Σημείο τήξης |
133℃ |
Σημείο βρασμού |
371°C at 760 mmHg |
Δείκτης διάθλασης |
1.563 |
Σημείο ανάφλεξης |
178.2°C |
Πίεση ατμών |
3.69E-06mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|