ChemNet > CAS > 2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
| Ονομασία του προϊόντος |
1,2,4-Trivinylcyclohexane, mixture of isomers |
| Αγγλικό όνομα |
1,2,4-Trivinylcyclohexane, mixture of isomers; cyclohexane-1,2,4-triyltris(ethylene); 1,2,4-Trivinyl cyclohexane = TVCH; 1,2,4-Trivinylcyclohexane; 1,2,4-triethenylcyclohexane |
| MF |
C12H18 |
| Μοριακό βάρος |
162.2713 |
| InChI |
InChI=1/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
| CAS ΟΧΙ |
2855-27-8 |
| EINECS |
220-668-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.96g/cm3 |
| Σημείο βρασμού |
198.4°C at 760 mmHg |
| Δείκτης διάθλασης |
1.628 |
| Σημείο ανάφλεξης |
68.9°C |
| Πίεση ατμών |
0.508mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
